![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | a-comparison-of-actors-wages/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | a-strange-tale-of-castaways-a-western-kabuki/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | actors-ichikawa-saidanji-ichikawa-4a63bdadb30afa8e/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | actors-kataoka-gado-nakamura-fukus-f9449a98fc91c4b/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | actors-sawamura-tossho-ii-as-genn-95cc42fe163315c8/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | actors-sawamura-tossho-ii-nakamur-c605bbf97b796b74/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | autumn-play-at-the-kabukiza---tok-545f1584111563a3/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | bando-hikosaburo-v-as-takegawa-no-25f7cf459dff1511/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | bando-hikosaburo-v-as-unryu-kuro--7ce9a832a7bf627f/ | 2021-09-29 18:09 | - | |
![[DIR]](/icons/folder.gif) | bando-hikosaburo-v-sawamura-tossh-65ec131d069b198e/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | beauty-drinking-tea-from-the-seri-c340ee9e4e8b05cf/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | collection-of-ten-plays-new-and-old---modoribashi/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | court-lady-uematsu-michiko-from-t-98ade4953f1c0541/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | court-lady-yanagihara-aiko-from-th-4c0eeda6868234d/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | depicting-the-actors-ichikawa-dan-22c9170349c8242a/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | dragon-and-snake-from-the-series--b4411ac74b1be769/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | geisha-from-the-hiramatsu-restaura-181a24e956f3321/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | geisha-stringing-a-shamisen-from--f09e127f6d8acfea/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | haiyu-mitate-asahi-shogun-eichu-no-zu/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | haiyu-mitate-junishi/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | honcho-nijushiko/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | ichikawa-danjuro-ix-as-daikokuya--e575bd7aab67b958/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | ichikawa-danjuro-ix-as-higuchi-ji-5dd973a894bbe8bb/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | ichikawa-danjuro-ix-as-iruka-and--a46d9ee75bc612ca/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | ichikawa-danjuro-ix-as-kirare-yozo-b8a40766fbf135a/ | 2021-09-29 18:10 | - | |
![[DIR]](/icons/folder.gif) | ichikawa-danjuro-ix-as-mongaku-sh-86ae206211520eb2/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | ichikawa-danjuro-ix-as-sendo-tomb-e8b2f075971fa4f7/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | ichikawa-danjuro-ix-as-the-fox-ta-f320478458bb8a6f/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | ichikawa-sadanji-as-the-monk-raigo-fc481691dc32f1d/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | ichimura-uzaemon-from-the-series-kabuki-36-poems/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | imoseyama-onna-teikin/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | index-from-the-series-one-hundred-roles-of-baiko/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | iwai-hanshiro-viii-ichikawa-danju-ac5c90eee85f8f99/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | iwai-hanshiro-viii-ichikawa-gonju-8d6650f8ddcc531b/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | kabukiza-sangatsu-okuyuki/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | kawarasaki-kunitaro-as-okaru-from-7adb79d3bf413c10/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | kijutsu-soroi-sannin-doji-a-gathe-416be284af4efa8d/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | mata-shime-kazari-isami-no-ebi-doko/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | merger-of-the-nakamura-and-shinbori-theatres/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | mirror-of-magical-heroes/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | miyakodori-nagare-no-shiranami/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | nakayama-genjuro-ii-as-udesuke-fr-5908cc332cf144fe/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | new-year-s-outing-before-a-suspension-bridge/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | no-10-sakaki-from-the-series-the--5942911e4364cc7c/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-as-hayano-kampei--778496f029679316/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-as-masaoka-from-t-9ea5d00392766552/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-as-mibu-no-kozaru-e4a47ca59d12d5f9/ | 2021-09-29 18:11 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-as-sakanaya-sogor-e35755ab35c6847a/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-as-shinohara-kunim-78c5baed9700dcb/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-as-the-priest-sei-ee451229fa997c6f/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-as-washi-no-choki-1f70d209678601c4/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-as-yashio-from-th-ccda14931435a3f9/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | onoe-kikugoro-v-in-the-role-of-ig-3522c86f4e92e191/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | onoe-taganojo-ii-as-kidomaru-ichi-bc48204293cdf3d5/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | orihime-no-shusu-enishi-no-iroito/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | parody-of-36-selected-beauties-an-52e33aa171ed9019/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | rainy-season-kimono-and-old-time-silks/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | ryuko-shiritori-kodomo-monku/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | sarumawashi-kado-de-no-hitofushi/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | sawamura-tossho-ii-as-tora-omaru--47a0c76b520afabe/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | september-kyogan-at-the-asakusa-za/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | shiraishi-banashi-myojin-mori-ba--87c087e961658fb0/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | shushiki-from-the-series-instruct-c0e80e35a91aadea/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | soga-brothers-new-year-s-farce/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | sukedakaya-takasuke-iv-ichikawa-d-9ebe812f6b5870af/ | 2021-09-29 18:12 | - | |
![[DIR]](/icons/folder.gif) | the-actor-bando-hikosaburo-v-as-i-876ae0031b25ac0d/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-actor-ichikawa-udanji-i-in-unidentified-role/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-actor-nakamura-shikan-in-the--fc340f5258e031c5/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-actors-ichikawa-danjuro-ichik-6cb93ccec5607407/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-actors-ichikawa-sadanji-ichik-c322aa5535339315/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-actors-ichikawa-sadanji-otani-35e8f693f5a68424/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-actors-onoe-kikugoro-v-ichika-3df34fa6f63f0cb8/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-actors-onoe-kikugoro-v-sawamu-59b351872ab09d86/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-actors-sawamura-tossho-ii-saw-cebc8b771f786b25/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-englishman-spencer-from-the-s-366553ecfd6d7826/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-kabuki-play-gempei-nunobiki-no-taki-/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-kabuki-play-oshu-adachi-ga-hara/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-manrin-restaurant-shinagawa-c-92c4d9c127d18b51/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-scene-kumagai-jin-ya-from-the-212c7fc9b5705f06/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-seventh-month-suketakaya-taka-a5719e6602712bbc/ | 2021-09-29 18:13 | - | |
![[DIR]](/icons/folder.gif) | the-subscription-list/ | 2021-09-29 18:14 | - | |
![[DIR]](/icons/folder.gif) | tiger-and-hare-from-the-series-ha-f94a8692235607e4/ | 2021-09-29 18:14 | - | |
![[DIR]](/icons/folder.gif) | torii-tsuneemon-from-the-series-o-4fcb8410d3cdf4ae/ | 2021-09-29 18:14 | - | |
![[DIR]](/icons/folder.gif) | unidentified-actor-as-fusanosuke--ce85eae875427e32/ | 2021-09-29 18:14 | - | |
![[DIR]](/icons/folder.gif) | unidentified-actor-as-saburo-from-1150c0fb9cdafdf4/ | 2021-09-29 18:14 | - | |
![[DIR]](/icons/folder.gif) | ura-omote-yanagi-no-uchiwae/ | 2021-09-29 18:14 | - | |
![[DIR]](/icons/folder.gif) | who-will-be-first-to-select-among-d36404c89b36e7b5/ | 2021-09-29 18:14 | - | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-as-hayano-kampe | 2021-09-29 07:51 | 1.3K | |
![[IMG]](/icons/image2.gif) | dragon-and-snake-from-the-serie | 2021-09-29 07:51 | 1.4K | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-as-the-priest-s | 2021-09-29 07:51 | 1.5K | |
![[IMG]](/icons/image2.gif) | autumn-play-at-the-kabukiza---t | 2021-09-29 07:51 | 1.7K | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-in-the-role-of- | 2021-09-29 07:51 | 2.1K | |
![[IMG]](/icons/image2.gif) | parody-of-36-selected-beauties- | 2021-09-29 07:51 | 2.1K | |
![[IMG]](/icons/image2.gif) | the-actors-onoe-kikugoro-v-sawa | 2021-09-29 07:51 | 2.3K | |
![[IMG]](/icons/image2.gif) | actors-sawamura-tossho-ii-nakam | 2021-09-29 07:51 | 2.3K | |
![[IMG]](/icons/image2.gif) | the-kabuki-play-oshu-adachi-ga- | 2021-09-29 07:51 | 2.3K | |
![[IMG]](/icons/image2.gif) | bando-hikosaburo-v-as-takegawa- | 2021-09-29 07:51 | 2.4K | |
![[IMG]](/icons/image2.gif) | new-year-s-outing-before-a-susp | 2021-09-29 07:51 | 2.6K | |
![[IMG]](/icons/image2.gif) | who-will-be-first-to-select-amo | 2021-09-29 07:51 | 2.6K | |
![[IMG]](/icons/image2.gif) | mata-shime-kazari-isami-no-ebi- | 2021-09-29 07:51 | 2.7K | |
![[IMG]](/icons/image2.gif) | kawarasaki-kunitaro-as-okaru-fr | 2021-09-29 07:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | unidentified-actor-as-saburo-fr | 2021-09-29 07:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | the-actor-bando-hikosaburo-v-as | 2021-09-29 07:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | the-actors-sawamura-tossho-ii-s | 2021-09-29 07:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | tiger-and-hare-from-the-series- | 2021-09-29 07:51 | 3.0K | |
![[IMG]](/icons/image2.gif) | ichikawa-danjuro-ix-as-kirare-y | 2021-09-29 07:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | the-scene-kumagai-jin-ya-from-t | 2021-09-29 07:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | the-actor-ichikawa-udanji-i-in- | 2021-09-29 07:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | the-actors-onoe-kikugoro-v-ichi | 2021-09-29 07:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | collection-of-ten-plays-new-and | 2021-09-29 07:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | shiraishi-banashi-myojin-mori-b | 2021-09-29 07:51 | 3.5K | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-as-yashio-from- | 2021-09-29 07:51 | 3.6K | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-as-sakanaya-sog | 2021-09-29 07:51 | 3.6K | |
![[IMG]](/icons/image2.gif) | nakayama-genjuro-ii-as-udesuke- | 2021-09-29 07:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | rainy-season-kimono-and-old-tim | 2021-09-29 07:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | geisha-from-the-hiramatsu-resta | 2021-09-29 07:51 | 4.0K | |
![[IMG]](/icons/image2.gif) | bando-hikosaburo-v-sawamura-tos | 2021-09-29 07:51 | 4.1K | |
![[IMG]](/icons/image2.gif) | actors-sawamura-tossho-ii-as-ge | 2021-09-29 07:51 | 4.1K | |
![[IMG]](/icons/image2.gif) | september-kyogan-at-the-asakusa | 2021-09-29 07:51 | 4.2K | |
![[IMG]](/icons/image2.gif) | onoe-taganojo-ii-as-kidomaru-ic | 2021-09-29 07:51 | 4.6K | |
![[IMG]](/icons/image2.gif) | actors-kataoka-gado-nakamura-fu | 2021-09-29 07:51 | 4.7K | |
![[IMG]](/icons/image2.gif) | ichikawa-danjuro-ix-as-sendo-to | 2021-09-29 07:51 | 4.8K | |
![[IMG]](/icons/image2.gif) | sukedakaya-takasuke-iv-ichikawa | 2021-09-29 07:51 | 5.2K | |
![[IMG]](/icons/image2.gif) | iwai-hanshiro-viii-ichikawa-dan | 2021-09-29 07:51 | 5.3K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Sawamura-Tos-4 | 2021-09-29 07:51 | 5.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Sawamura-Tos-45592c7c8cb543e4.jpg | 2021-10-06 07:49 | 5.4K | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-as-shinohara-ku | 2021-09-29 07:51 | 5.4K | |
![[IMG]](/icons/image2.gif) | index-from-the-series-one-hundr | 2021-09-29 07:51 | 5.7K | |
![[IMG]](/icons/image2.gif) | beauty-drinking-tea-from-the-se | 2021-09-29 07:51 | 5.7K | |
![[IMG]](/icons/image2.gif) | unidentified-actor-as-fusanosuk | 2021-09-29 07:51 | 5.8K | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-as-washi-no-cho | 2021-09-29 07:51 | 5.9K | |
![[IMG]](/icons/image2.gif) | ichikawa-danjuro-ix-as-higuchi- | 2021-09-29 07:51 | 5.9K | |
![[IMG]](/icons/image2.gif) | court-lady-yanagihara-aiko-from | 2021-09-29 07:51 | 6.1K | |
![[IMG]](/icons/image2.gif) | haiyu-mitate-asahi-shogun-eichu | 2021-09-29 07:51 | 6.1K | |
![[IMG]](/icons/image2.gif) | torii-tsuneemon-from-the-series | 2021-09-29 07:51 | 6.3K | |
![[IMG]](/icons/image2.gif) | Kunichika-Kabukiza-sangatsu-o-2 | 2021-09-29 07:51 | 6.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-Kabukiza-sangatsu-o-2f26bcb4829c6ca0.jpg | 2021-10-06 07:49 | 6.4K | |
![[IMG]](/icons/image2.gif) | ichikawa-danjuro-ix-as-mongaku- | 2021-09-29 07:51 | 6.7K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Subscription-List--1 | 2021-09-29 07:51 | 7.0K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Subscription-List--1fb141500e271ce8.jpg | 2021-10-06 07:48 | 7.0K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-Actor-Ichikawa--6 | 2021-09-29 07:51 | 7.1K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-Actor-Ichikawa--63cf940e6afa821c.jpg | 2021-10-06 07:49 | 7.1K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-Actor-Ichikawa--d | 2021-09-29 07:51 | 7.1K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-Actor-Ichikawa--df1d7ee6469ee7fa.jpg | 2021-10-06 07:49 | 7.1K | |
![[IMG]](/icons/image2.gif) | Kumagai-Jin_ya-scene-from-the-b | 2021-09-29 07:51 | 7.2K | |
![[IMG]](/icons/image2.gif) | Kumagai-Jin_ya-scene-from-the-bfdaa0b405abecbf.jpg | 2021-10-06 07:48 | 7.2K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Ichikawa-Dan-8 | 2021-09-29 07:51 | 7.2K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Ichikawa-Dan-8631c7cc8226878e.jpg | 2021-10-06 07:49 | 7.2K | |
![[IMG]](/icons/image2.gif) | merger-of-the-nakamura-and-shin | 2021-09-29 07:51 | 7.3K | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-as-masaoka-from | 2021-09-29 07:51 | 7.4K | |
![[IMG]](/icons/image2.gif) | ichikawa-danjuro-ix-as-daikokuy | 2021-09-29 07:51 | 7.8K | |
![[IMG]](/icons/image2.gif) | Kunichika---The-Actors-Onoe-K-3 | 2021-09-29 07:51 | 8.0K | |
![[IMG]](/icons/image2.gif) | Kunichika---The-Actors-Onoe-K-3aaebdf5a9eb66b1.jpg | 2021-10-06 07:49 | 8.0K | |
![[IMG]](/icons/image2.gif) | Kunichika---The-Actors-Onoe-K-5 | 2021-09-29 07:51 | 8.0K | |
![[IMG]](/icons/image2.gif) | Kunichika---The-Actors-Onoe-K-5dd0351f2468ed3f.jpg | 2021-10-06 07:49 | 8.0K | |
![[IMG]](/icons/image2.gif) | the-actors-ichikawa-sadanji-ota | 2021-09-29 07:51 | 8.1K | |
![[IMG]](/icons/image2.gif) | Kunichika---The-Actors-Onoe-K-8 | 2021-09-29 07:51 | 8.1K | |
![[IMG]](/icons/image2.gif) | Kunichika---The-Actors-Onoe-K-8d24038d59c8d3e9.jpg | 2021-10-06 07:49 | 8.1K | |
![[IMG]](/icons/image2.gif) | Kunichika,-the-five-actors-Ic-c | 2021-09-29 07:51 | 8.5K | |
![[IMG]](/icons/image2.gif) | Kunichika,-the-five-actors-Ic-c11f7af49e85199e.jpg | 2021-10-06 07:49 | 8.5K | |
![[IMG]](/icons/image2.gif) | Kunichika-Kyosai-New-Years-ou-8 | 2021-09-29 07:51 | 8.7K | |
![[IMG]](/icons/image2.gif) | Kunichika-Kyosai-New-Years-ou-8b97ad50a9d60d35.jpg | 2021-10-06 07:49 | 8.7K | |
![[IMG]](/icons/image2.gif) | onoe-kikugoro-v-as-mibu-no-koza | 2021-09-29 07:51 | 8.7K | |
![[IMG]](/icons/image2.gif) | Kunichika---The-Actors-Onoe-Ki- | 2021-09-29 07:51 | 8.8K | |
![[IMG]](/icons/image2.gif) | Kunichika---The-Actors-Onoe-Ki-58a07fb69d48936.jpg | 2021-10-06 07:49 | 8.8K | |
![[IMG]](/icons/image2.gif) | Toyohara-kunichika-ga.jpg | 2021-10-06 07:49 | 8.8K | |
![[IMG]](/icons/image2.gif) | Kunichika,-5-actors-as-Yurano-5 | 2021-09-29 07:51 | 8.8K | |
![[IMG]](/icons/image2.gif) | Kunichika,-5-actors-as-Yurano-541e1ad821f07ff1.jpg | 2021-10-06 07:48 | 8.8K | |
![[IMG]](/icons/image2.gif) | Kunichika,-actors-Ichikawa-Da-2 | 2021-09-29 07:51 | 9.0K | |
![[IMG]](/icons/image2.gif) | Kunichika,-actors-Ichikawa-Da-298346897702d246.jpg | 2021-10-06 07:48 | 9.0K | |
![[IMG]](/icons/image2.gif) | Kumagai-Jin-ya-scene-from-the-10d9003af1fcc7b4.jpg | 2021-10-12 08:44 | 9.2K | |
![[IMG]](/icons/image2.gif) | Kumagai-Jin_ya-scene-from-the-4d8900456ca54f15.jpg | 2021-10-06 07:48 | 9.2K | |
![[IMG]](/icons/image2.gif) | Kunichika-#291-with-actor-lab-6 | 2021-09-29 07:51 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-#291-with-actor-lab-6c2801090970d159.jpg | 2021-10-06 07:49 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-#291-with-actor-lab-d | 2021-09-29 07:51 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-#291-with-actor-lab-ddb5135bf7b347e2.jpg | 2021-10-06 07:49 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-291-with-actor-labe-5 | 2021-09-29 07:51 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-291-with-actor-labe-5828c2916a2458e4.jpg | 2021-10-06 07:49 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-#292-unidentified-k-1 | 2021-09-29 07:51 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-#292-unidentified-k-119a497788c3b4b1.jpg | 2021-10-06 07:49 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-#292-unidentified-kab | 2021-09-29 07:51 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika-#292-unidentified-kabuki-play-i.jpg | 2021-10-06 07:49 | 9.4K | |
![[IMG]](/icons/image2.gif) | Kunichika Modoribashi ihl cat-1 | 2021-09-29 07:51 | 9.5K | |
![[IMG]](/icons/image2.gif) | Kunichika Modoribashi ihl cat-1042a867628db53a.jpg | 2021-10-06 07:48 | 9.5K | |
![[IMG]](/icons/image2.gif) | The-Actor-Nakamura-Shikan-in--5 | 2021-09-29 07:51 | 9.5K | |
![[IMG]](/icons/image2.gif) | The-Actor-Nakamura-Shikan-in--565f056bd575d2e3.jpg | 2021-10-06 07:49 | 9.5K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Subscription-List--a | 2021-09-29 07:51 | 9.6K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Subscription-List--aa6340f47211718a.jpg | 2021-10-06 07:49 | 9.6K | |
![[IMG]](/icons/image2.gif) | Kunichika-A-Strange-Tale-of-C-9 | 2021-09-29 07:51 | 9.8K | |
![[IMG]](/icons/image2.gif) | Kunichika-A-Strange-Tale-of-C-95dc3f4a383e6fbf.jpg | 2021-10-06 07:49 | 9.8K | |
![[IMG]](/icons/image2.gif) | Kunichika-Sarumawashi-Kadode--b | 2021-09-29 07:51 | 9.9K | |
![[IMG]](/icons/image2.gif) | Kunichika-Sarumawashi-Kadode--b4ea239daa5a55be.jpg | 2021-10-06 07:49 | 9.9K | |
![[IMG]](/icons/image2.gif) | Kunichika Fall Kyogen at the -3 | 2021-09-29 07:51 | 10K | |
![[IMG]](/icons/image2.gif) | Kunichika Fall Kyogen at the -34a1fe13a6875b8b.jpg | 2021-10-06 07:48 | 10K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Battle-of-the-magi-b | 2021-09-29 07:51 | 10K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Battle-of-the-magi-bc9b233deb7a602f.jpg | 2021-10-06 07:48 | 10K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Sawamura-Tos-c | 2021-09-29 07:51 | 10K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Sawamura-Tos-ca0a58a50db5d280.jpg | 2021-10-06 07:49 | 10K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Sawamura-Toss- | 2021-09-29 07:51 | 10K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Sawamura-Toss-6437fa90f3ddddf.jpg | 2021-10-06 07:49 | 10K | |
![[IMG]](/icons/image2.gif) | Toyohara-Kunichika-hitsu-wi.jpg | 2021-10-06 07:49 | 10K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Tsuyu-kosode-mukas-9 | 2021-09-29 07:51 | 11K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Tsuyu-kosode-mukas-9b1fbbf16c8366ec.jpg | 2021-10-06 07:49 | 11K | |
![[IMG]](/icons/image2.gif) | Kumagai-Jin_ya-scene-from-the-9 | 2021-09-29 07:51 | 11K | |
![[IMG]](/icons/image2.gif) | Kumagai-Jin_ya-scene-from-the-939a4b705c2f5cd3.jpg | 2021-10-06 07:48 | 11K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugro V as the English-d | 2021-09-29 07:51 | 11K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugro V as the English-d6bf14a0004aa3d3.jpg | 2021-10-06 07:49 | 11K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ôshû-Adachi-ga-Hara | 2021-09-29 07:51 | 11K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ôshû-Adachi-ga-Hara-11d22846fbb43005.jpg | 2021-10-06 07:49 | 11K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ôshû-Adachi-ga-Hara-bb7b4aa060be99b8.jpg | 2021-10-06 07:49 | 11K | |
![[IMG]](/icons/image2.gif) | Ichikawa Danjuro IX as Kirare - | 2021-09-29 07:51 | 11K | |
![[IMG]](/icons/image2.gif) | Ichikawa Danjuro IX as Kirare -dafb6236c9e0356.jpg | 2021-10-06 07:48 | 11K | |
![[IMG]](/icons/image2.gif) | Fujiwara Playing the Flute ihl2 | 2021-09-29 07:51 | 11K | |
![[IMG]](/icons/image2.gif) | Fujiwara Playing the Flute ihl2176 thumb web.jpg | 2021-10-06 07:48 | 11K | |
![[IMG]](/icons/image2.gif) | ichikawa-sadanji-as-the-monk-ra | 2021-09-29 07:51 | 11K | |
![[IMG]](/icons/image2.gif) | Oju-toyohara-kunichika-hits.jpg | 2021-10-06 07:49 | 11K | |
![[IMG]](/icons/image2.gif) | Kunichika-hitsu.jpg | 2021-10-06 07:49 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ichikawa-Danjuro-as-4 | 2021-09-29 07:51 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ichikawa-Danjuro-as-49ed7202fa2016f7.jpg | 2021-10-06 07:49 | 12K | |
![[IMG]](/icons/image2.gif) | Ichikawa Danjuro IX as the Fo-8 | 2021-09-29 07:51 | 12K | |
![[IMG]](/icons/image2.gif) | Ichikawa Danjuro IX as the Fo-85b778cdeb2cfd5a.jpg | 2021-10-06 07:48 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ura-Omote-Yanagi-no-2 | 2021-09-29 07:51 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ura-Omote-Yanagi-no-2c09223b116ef708.jpg | 2021-10-06 07:49 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika Seven Actors ihl1691_ | 2021-09-29 07:51 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika Seven Actors ihl1691 thumb web.jpg | 2021-10-06 07:48 | 12K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Sakanaya S-6 | 2021-09-29 07:51 | 12K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Sakanaya S-614a4024ee26e8e8.jpg | 2021-10-06 07:49 | 12K | |
![[IMG]](/icons/image2.gif) | the-seventh-month-suketakaya-ta | 2021-09-29 07:51 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika-ryuko-shiritori-kod-c | 2021-09-29 07:51 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika-ryuko-shiritori-kod-c7654d3dc886153a.jpg | 2021-10-06 07:49 | 12K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Akashi no -3 | 2021-09-29 07:51 | 12K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Akashi no -3481c82196bcda0b.jpg | 2021-10-06 07:49 | 12K | |
![[IMG]](/icons/image2.gif) | Kunichika-Mata-551-thumb-we.jpg | 2021-10-06 07:49 | 13K | |
![[IMG]](/icons/image2.gif) | Beauty drinking tea from the -d | 2021-09-29 07:51 | 13K | |
![[IMG]](/icons/image2.gif) | Beauty drinking tea from the -d10f85da0aae755a.jpg | 2021-10-06 07:48 | 13K | |
![[IMG]](/icons/image2.gif) | Actors Kataoka Gado Nakamura -b | 2021-09-29 07:51 | 13K | |
![[IMG]](/icons/image2.gif) | Actors Kataoka Gado Nakamura -bc408b77d8f10629.jpg | 2021-10-06 07:48 | 13K | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -4 | 2021-09-29 07:51 | 13K | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -4dc2db7069b90976.jpg | 2021-10-06 07:48 | 13K | |
![[IMG]](/icons/image2.gif) | Kunichika-Nakayama-Genjuro-II-f | 2021-09-29 07:51 | 13K | |
![[IMG]](/icons/image2.gif) | Kunichika-Nakayama-Genjuro-II-faeb5ced327d686f.jpg | 2021-10-06 07:49 | 13K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Hayano Kam-d | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Hayano Kam-d81914befe33abf1.jpg | 2021-10-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika--Minori-no-aki-seis-8 | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika--Minori-no-aki-seis-88076cdcf87d8447.jpg | 2021-10-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika Matsu no Sakae Chiy-6 | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika Matsu no Sakae Chiy-67afbc4833b78ef7.jpg | 2021-10-06 07:48 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ichikawa-Danjuro-as-- | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ichikawa-Danjuro-as--967ea9b9eabb6d7.jpg | 2021-10-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | Kikugoro V as Washi no Chokic-f | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | Kikugoro V as Washi no Chokic-fce7fdb661cde7d5.jpg | 2021-10-06 07:48 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika Kogen Kusazuribiki -8 | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika Kogen Kusazuribiki -8f2df6d2bca25eb6.jpg | 2021-10-06 07:48 | 14K | |
![[IMG]](/icons/image2.gif) | Signature-300hx67w-web.jpg | 2021-10-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | The Morning East Wind Clearin-e | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | The Morning East Wind Clearin-e75769961e3f29f4.jpg | 2021-10-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ichikawa-Danjuro-as-c | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ichikawa-Danjuro-as-cb190eaec4ac820a.jpg | 2021-10-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika-ga.jpg | 2021-10-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-Actors-Sawamura-9 | 2021-09-29 07:51 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-Actors-Sawamura-9d306a912470c247.jpg | 2021-10-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -f | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -f19fd761d8a727d3.jpg | 2021-10-06 07:48 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -f5234dc17cc1d8a2.jpg | 2021-10-06 07:48 | 15K | |
![[IMG]](/icons/image2.gif) | Shiraishi-banashi-myojin-mori-b03c6e5390ffc7a5.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | the-englishman-spencer-from-the | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-Shikishi-Loft-Ambit-a | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-Shikishi-Loft-Ambit-a22c221dc4fff48e.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | Title page ihl2156 thumb web.jp | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Title page ihl2156 thumb web.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Mibu no Ko-b | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Mibu no Ko-bfd7cbc0f5e2643d.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Gonta IHL215 | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Gonta IHL2159 thumb web.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-September-Kyogen-at-4 | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-September-Kyogen-at-425c63d81e598fc5.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika Kawarasaki Kunitaro-6 | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika Kawarasaki Kunitaro-6d13705c404dbbd7.jpg | 2021-10-06 07:48 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika Gathering of Three -c | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika Gathering of Three -cee14467fe194dd8.jpg | 2021-10-06 07:48 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-Banzuke-tirptych-ih-9 | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-Banzuke-tirptych-ih-98c3148c56df5bf0.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-Honcho-Nijushiko-ih-1 | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-Honcho-Nijushiko-ih-127ecd580737ac19.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-Bando-Hikosaburo-V--a | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Kunichika-Bando-Hikosaburo-V--aa4846e207833be9.jpg | 2021-10-06 07:49 | 15K | |
![[IMG]](/icons/image2.gif) | Haiyu mitate asahi shogun eic-c | 2021-09-29 07:51 | 15K | |
![[IMG]](/icons/image2.gif) | Haiyu mitate asahi shogun eic-cdc3f61806295c50.jpg | 2021-10-06 07:48 | 15K | |
![[IMG]](/icons/image2.gif) | The scene Kumagai Jinya from -8 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | The scene Kumagai Jinya from -828f410040826769.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika Saburo No 62 from th- | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika Saburo No 62 from th-c539b76f10f8173.jpg | 2021-10-06 07:48 | 16K | |
![[IMG]](/icons/image2.gif) | Ichikawa-Sadanji-as-the-monk--9 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Ichikawa-Sadanji-as-the-monk--9cf53adf36ad15f6.jpg | 2021-10-06 07:48 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-KiNPEIBAI-SATO-no-S-3 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-KiNPEIBAI-SATO-no-S-335c567399f12000.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Daikon-kabuki-ihl-c-a | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Daikon-kabuki-ihl-c-a12bf2d93cc63ce5.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Parody of 36 Selected Poems O-b | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Parody of 36 Selected Poems O-b67cb24e0d10d3fd.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Masaoka ih-5 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Masaoka ih-53f0d3bf5dbd431d.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Naming Ceremony diptych ihl c-5 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Naming Ceremony diptych ihl c-5b75ca38163dd6ac.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | The Manrin Restaurant 36 Mode-9 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | The Manrin Restaurant 36 Mode-920714dd3bb9d862.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Imoseyama-Onna-Teik-4 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Imoseyama-Onna-Teik-41cddc5b7f03de0f.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Kumagai-Jinya-ihl-c-e | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Kumagai-Jinya-ihl-c-ea46337ba1523bc4.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika Ichikawa Danuro IX a- | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika Ichikawa Danuro IX a-f807a274c28d194.jpg | 2021-10-06 07:48 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Sawamura-Tos-9 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Actors-Sawamura-Tos-95d620b4aee7ee47.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Miyakodori-Nagare-n-7 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Miyakodori-Nagare-n-7a390642a0438b2f.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Orihime-no-Shusu-Eni- | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Orihime-no-Shusu-Eni-b2e688a06f9be9b.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Bando-Higosaburo-V--5 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Bando-Higosaburo-V--52d39b19342fd05b.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-seventh-month.--5 | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-seventh-month.--585cf3e28c510c43.jpg | 2021-10-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika Ichikawa Danjuro IX-b | 2021-09-29 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika Ichikawa Danjuro IX-b15b04db1aa2563d.jpg | 2021-10-06 07:48 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-Orihime-no-Shusu-En-3 | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Orihime-no-Shusu-En-3cf098cf6fcb3421.jpg | 2021-10-06 07:49 | 17K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Torii Tsun-7 | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Torii Tsun-72bd4c6b5fb7fe4f.jpg | 2021-10-06 07:49 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika Bonokai No.57 from-d | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika Bonokai No.57 from-df0fc7fadac52e46.jpg | 2021-10-06 07:48 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika Bonokai No.57 from-f | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika Bonokai No.57 from-f3014c21ba5c598e.jpg | 2021-10-06 07:48 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ichimura-Uzaemon-Ka-4 | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Ichimura-Uzaemon-Ka-4cbf5dcb12eeb062.jpg | 2021-10-06 07:49 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Geisha-from-the-Hir-c | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Geisha-from-the-Hir-cadd866047dac14c.jpg | 2021-10-06 07:49 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichiuka Lady Jugoi Uematsu-6 | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichiuka Lady Jugoi Uematsu-68d0783144c2bc0e.jpg | 2021-10-06 07:49 | 17K | |
![[IMG]](/icons/image2.gif) | Yanagihara Aiko playing a sho-2 | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Yanagihara Aiko playing a sho-21031fc08213b8fb.jpg | 2021-10-06 07:49 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Geisha-stringing-sh-4 | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Geisha-stringing-sh-4de22d2edfd42053.jpg | 2021-10-06 07:49 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Sakaki-54-modern-fe-6 | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kunichika-Sakaki-54-modern-fe-6a9924866c2e3921.jpg | 2021-10-06 07:49 | 17K | |
![[IMG]](/icons/image2.gif) | Kikugoro V as Yashio and Danj-f | 2021-09-29 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Kikugoro V as Yashio and Danj-f0ec25e1b29c3e73.jpg | 2021-10-06 07:48 | 17K | |
![[IMG]](/icons/image2.gif) | Imoseyama Onna Teikin IHL1001 t | 2021-09-29 07:51 | 18K | |
![[IMG]](/icons/image2.gif) | Imoseyama Onna Teikin IHL1001 thumb web.jpg | 2021-10-06 07:48 | 18K | |
![[IMG]](/icons/image2.gif) | Kunichika-Sawamura-Tossho-II--8 | 2021-09-29 07:51 | 18K | |
![[IMG]](/icons/image2.gif) | Kunichika-Sawamura-Tossho-II--8240d62a7898458a.jpg | 2021-10-06 07:49 | 18K | |
![[IMG]](/icons/image2.gif) | Toyohara-Kunichika-Kawarazaki-2 | 2021-09-29 07:51 | 18K | |
![[IMG]](/icons/image2.gif) | Toyohara-Kunichika-Kawarazaki-2e0f2a611757fbec.jpg | 2021-10-06 07:49 | 18K | |
![[IMG]](/icons/image2.gif) | Toyohara-Kunichika-Kawarazaki-d | 2021-09-29 07:51 | 18K | |
![[IMG]](/icons/image2.gif) | Toyohara-Kunichika-Kawarazaki-d41d8c0ea14f32ff.jpg | 2021-10-06 07:49 | 18K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Shinohara -d | 2021-09-29 07:51 | 19K | |
![[IMG]](/icons/image2.gif) | Onoe Kikugoro V as Shinohara -d505e5ff535cc595.jpg | 2021-10-06 07:49 | 19K | |
![[IMG]](/icons/image2.gif) | Kunichika-Kawarazaki-Sansho-a-b | 2021-09-29 07:51 | 21K | |
![[IMG]](/icons/image2.gif) | Kunichika-Kawarazaki-Sansho-a-b4311a6202c92dfa.jpg | 2021-10-06 07:49 | 21K | |
![[IMG]](/icons/image2.gif) | a-strange-tale-of-castaways-a-w | 2021-09-29 07:51 | 21K | |
![[IMG]](/icons/image2.gif) | Kunichika-Haiyu-Mitate-Junish-6 | 2021-09-29 07:51 | 21K | |
![[IMG]](/icons/image2.gif) | Kunichika-Haiyu-Mitate-Junish-69be2ed81aa94cec.jpg | 2021-10-06 07:49 | 21K | |
![[IMG]](/icons/image2.gif) | Kunichika Haiyu Mitate Junish-b | 2021-09-29 07:51 | 21K | |
![[IMG]](/icons/image2.gif) | Kunichika Haiyu Mitate Junish-b2862a7e235f444d.jpg | 2021-10-06 07:48 | 21K | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -9 | 2021-09-29 07:51 | 29K | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -90db56b044c40c09.jpg | 2021-10-06 07:48 | 29K | |
![[IMG]](/icons/image2.gif) | Toyohara-Kunichika-photo-1-20-d | 2021-09-29 07:51 | 32K | |
![[IMG]](/icons/image2.gif) | Toyohara-Kunichika-photo-1-20-da1ad2f17fdf9a54.jpg | 2021-10-06 07:49 | 32K | |
![[IMG]](/icons/image2.gif) | Toyohara-Kunichika-photo.jpg | 2021-10-06 07:49 | 32K | |
![[IMG]](/icons/image2.gif) | sarumawashi-kado-de-no-hitofush | 2021-09-29 07:51 | 35K | |
![[IMG]](/icons/image2.gif) | actors-ichikawa-saidanji-ichika | 2021-09-29 07:51 | 59K | |
![[IMG]](/icons/image2.gif) | depicting-the-actors-ichikawa-d | 2021-09-29 07:51 | 88K | |
![[IMG]](/icons/image2.gif) | ichikawa-danjuro-ix-as-the-fox- | 2021-09-29 07:51 | 125K | |
![[IMG]](/icons/image2.gif) | ichimura-uzaemon-from-the-serie | 2021-09-29 07:51 | 137K | |
![[IMG]](/icons/image2.gif) | the-actor-nakamura-shikan-in-th | 2021-09-29 07:51 | 140K | |
![[IMG]](/icons/image2.gif) | orihime-no-shusu-enishi-no-iroi | 2021-09-29 07:51 | 163K | |
![[IMG]](/icons/image2.gif) | iwai-hanshiro-viii-ichikawa-gon | 2021-09-29 07:51 | 176K | |
![[IMG]](/icons/image2.gif) | the-manrin-restaurant-shinagawa | 2021-09-29 07:51 | 187K | |
![[IMG]](/icons/image2.gif) | sawamura-tossho-ii-as-tora-omar | 2021-09-29 07:51 | 244K | |
![[IMG]](/icons/image2.gif) | shushiki-from-the-series-instru | 2021-09-29 07:51 | 360K | |
![[IMG]](/icons/image2.gif) | court-lady-uematsu-michiko-from | 2021-09-29 07:51 | 373K | |
![[IMG]](/icons/image2.gif) | the-kabuki-play-gempei-nunobiki | 2021-09-29 07:51 | 412K | |
![[TXT]](/icons/text.gif) | geisha-stringing-a-shamisen-from--f09e127f6d8acfea.html | 2021-10-06 07:48 | 531K | |
![[TXT]](/icons/text.gif) | soga-brothers-new-year-s-farce.html | 2021-10-06 07:49 | 532K | |
![[TXT]](/icons/text.gif) | the-actors-sawamura-tossho-ii-saw-cebc8b771f786b25.html | 2021-10-06 07:49 | 532K | |
![[TXT]](/icons/text.gif) | ryuko-shiritori-kodomo-monku.html | 2021-10-06 07:49 | 533K | |
![[TXT]](/icons/text.gif) | haiyu-mitate-asahi-shogun-eichu-no-zu.html | 2021-10-06 07:48 | 533K | |
![[TXT]](/icons/text.gif) | rainy-season-kimono-and-old-time-silks.html | 2021-10-06 07:49 | 533K | |
![[TXT]](/icons/text.gif) | who-will-be-first-to-select-among-d36404c89b36e7b5.html | 2021-10-06 07:49 | 533K | |
![[TXT]](/icons/text.gif) | soga-brothers-new-year-s-farce_ | 2021-09-29 07:51 | 533K | |
![[TXT]](/icons/text.gif) | kabukiza-sangatsu-okuyuki.html | 2021-10-06 07:48 | 533K | |
![[TXT]](/icons/text.gif) | actors-sawamura-tossho-ii-as-genn-95cc42fe163315c8.html | 2021-10-06 07:48 | 533K | |
![[TXT]](/icons/text.gif) | kijutsu-soroi-sannin-doji-a-gathe-416be284af4efa8d.html | 2021-10-06 07:48 | 533K | |
![[TXT]](/icons/text.gif) | sukedakaya-takasuke-iv-ichikawa-d-9ebe812f6b5870af.html | 2021-10-06 07:49 | 533K | |
![[TXT]](/icons/text.gif) | sarumawashi-kado-de-no-hitofushi.html | 2021-10-06 07:49 | 533K | |
![[TXT]](/icons/text.gif) | no-10-sakaki-from-the-series-the--5942911e4364cc7c.html | 2021-10-06 07:49 | 533K | |
![[TXT]](/icons/text.gif) | the-seventh-month-suketakaya-taka-a5719e6602712bbc.html | 2021-10-06 07:49 | 534K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-as-mibu-no-kozaru-e4a47ca59d12d5f9.html | 2021-10-06 07:49 | 534K | |
![[TXT]](/icons/text.gif) | ryuko-shiritori-kodomo-monku.ht | 2021-09-29 07:51 | 534K | |
![[TXT]](/icons/text.gif) | depicting-the-actors-ichikawa-dan-22c9170349c8242a.html | 2021-10-06 07:48 | 534K | |
![[TXT]](/icons/text.gif) | unidentified-actor-as-fusanosuke--ce85eae875427e32.html | 2021-10-06 07:49 | 534K | |
![[TXT]](/icons/text.gif) | onoe-taganojo-ii-as-kidomaru-ichi-bc48204293cdf3d5.html | 2021-10-06 07:49 | 534K | |
![[TXT]](/icons/text.gif) | new-year-s-outing-before-a-suspension-bridge.html | 2021-10-06 07:49 | 534K | |
![[TXT]](/icons/text.gif) | the-actor-nakamura-shikan-in-the--fc340f5258e031c5.html | 2021-10-06 07:49 | 534K | |
![[TXT]](/icons/text.gif) | ichikawa-sadanji-as-the-monk-raigo-fc481691dc32f1d.html | 2021-10-06 07:48 | 534K | |
![[TXT]](/icons/text.gif) | kawarasaki-kunitaro-as-okaru-from-7adb79d3bf413c10.html | 2021-10-06 07:48 | 534K | |
![[TXT]](/icons/text.gif) | nakayama-genjuro-ii-as-udesuke-fr-5908cc332cf144fe.html | 2021-10-06 07:49 | 534K | |
![[TXT]](/icons/text.gif) | bando-hikosaburo-v-as-takegawa-no-25f7cf459dff1511.html | 2021-10-06 07:48 | 534K | |
![[TXT]](/icons/text.gif) | mirror-of-magical-heroes.html | 2021-10-06 07:49 | 534K | |
![[TXT]](/icons/text.gif) | bando-hikosaburo-v-as-unryu-kuro--7ce9a832a7bf627f.html | 2021-10-06 07:48 | 535K | |
![[TXT]](/icons/text.gif) | the-actor-bando-hikosaburo-v-as-i-876ae0031b25ac0d.html | 2021-10-06 07:49 | 535K | |
![[TXT]](/icons/text.gif) | beauty-drinking-tea-from-the-seri-c340ee9e4e8b05cf.html | 2021-10-06 07:48 | 535K | |
![[TXT]](/icons/text.gif) | ichikawa-danjuro-ix-as-higuchi-ji-5dd973a894bbe8bb.html | 2021-10-06 07:48 | 535K | |
![[TXT]](/icons/text.gif) | unidentified-actor-as-saburo-from-1150c0fb9cdafdf4.html | 2021-10-06 07:49 | 535K | |
![[TXT]](/icons/text.gif) | iwai-hanshiro-viii-ichikawa-gonju-8d6650f8ddcc531b.html | 2021-10-06 07:48 | 535K | |
![[TXT]](/icons/text.gif) | ichikawa-danjuro-ix-as-daikokuya--e575bd7aab67b958.html | 2021-10-06 07:48 | 535K | |
![[TXT]](/icons/text.gif) | mata-shime-kazari-isami-no-ebi-doko.html | 2021-10-06 07:49 | 535K | |
![[TXT]](/icons/text.gif) | ichikawa-danjuro-ix-as-mongaku-sh-86ae206211520eb2.html | 2021-10-06 07:48 | 536K | |
![[TXT]](/icons/text.gif) | ura-omote-yanagi-no-uchiwae.html | 2021-10-06 07:49 | 536K | |
![[TXT]](/icons/text.gif) | haiyu-mitate-junishi.html | 2021-10-06 07:48 | 536K | |
![[TXT]](/icons/text.gif) | the-actors-onoe-kikugoro-v-ichika-3df34fa6f63f0cb8.html | 2021-10-06 07:49 | 536K | |
![[TXT]](/icons/text.gif) | tiger-and-hare-from-the-series-ha-f94a8692235607e4.html | 2021-10-06 07:49 | 536K | |
![[TXT]](/icons/text.gif) | ichikawa-danjuro-ix-as-sendo-tomb-e8b2f075971fa4f7.html | 2021-10-06 07:48 | 536K | |
![[TXT]](/icons/text.gif) | dragon-and-snake-from-the-series--b4411ac74b1be769.html | 2021-10-06 07:48 | 536K | |
![[TXT]](/icons/text.gif) | collection-of-ten-plays-new-and-old---modoribashi.html | 2021-10-06 07:48 | 536K | |
![[TXT]](/icons/text.gif) | autumn-play-at-the-kabukiza---tok-545f1584111563a3.html | 2021-10-06 07:48 | 536K | |
![[TXT]](/icons/text.gif) | index-from-the-series-one-hundred-roles-of-baiko.html | 2021-10-06 07:48 | 536K | |
![[TXT]](/icons/text.gif) | the-kabuki-play-oshu-adachi-ga-hara.html | 2021-10-06 07:49 | 536K | |
![[TXT]](/icons/text.gif) | court-lady-uematsu-michiko-from-t-98ade4953f1c0541.html | 2021-10-06 07:48 | 536K | |
![[TXT]](/icons/text.gif) | the-actor-ichikawa-udanji-i-in-unidentified-role.html | 2021-10-06 07:49 | 536K | |
![[TXT]](/icons/text.gif) | the-subscription-list.html | 2021-10-06 07:49 | 536K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-as-washi-no-choki-1f70d209678601c4.html | 2021-10-06 07:49 | 536K | |
![[TXT]](/icons/text.gif) | a-strange-tale-of-castaways-a-western-kabuki.html | 2021-10-06 07:48 | 537K | |
![[TXT]](/icons/text.gif) | orihime-no-shusu-enishi-no-iroito.html | 2021-10-06 07:49 | 537K | |
![[TXT]](/icons/text.gif) | ura-omote-yanagi-no-uchiwae.htm | 2021-09-29 07:51 | 537K | |
![[TXT]](/icons/text.gif) | miyakodori-nagare-no-shiranami.html | 2021-10-06 07:49 | 537K | |
![[TXT]](/icons/text.gif) | the-manrin-restaurant-shinagawa-c-92c4d9c127d18b51.html | 2021-10-06 07:49 | 537K | |
![[TXT]](/icons/text.gif) | bando-hikosaburo-v-sawamura-tossh-65ec131d069b198e.html | 2021-10-06 07:48 | 537K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-as-shinohara-kunim-78c5baed9700dcb.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | shiraishi-banashi-myojin-mori-ba--87c087e961658fb0.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | the-kabuki-play-gempei-nunobiki-no-taki-.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-as-sakanaya-sogor-e35755ab35c6847a.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | honcho-nijushiko.html | 2021-10-06 07:48 | 538K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-in-the-role-of-ig-3522c86f4e92e191.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | court-lady-yanagihara-aiko-from-th-4c0eeda6868234d.html | 2021-10-06 07:48 | 538K | |
![[TXT]](/icons/text.gif) | torii-tsuneemon-from-the-series-o-4fcb8410d3cdf4ae.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | ichikawa-danjuro-ix-as-the-fox-ta-f320478458bb8a6f.html | 2022-05-26 16:36 | 538K | |
![[TXT]](/icons/text.gif) | miyakodori-nagare-no-shiranami_ | 2021-09-29 07:51 | 538K | |
![[TXT]](/icons/text.gif) | ichikawa-danjuro-ix-as-kirare-yozo-b8a40766fbf135a.html | 2021-10-06 07:48 | 538K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-as-hayano-kampei--778496f029679316.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-as-the-priest-sei-ee451229fa997c6f.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | merger-of-the-nakamura-and-shinbori-theatres.html | 2021-10-06 07:49 | 538K | |
![[TXT]](/icons/text.gif) | actors-kataoka-gado-nakamura-fukus-f9449a98fc91c4b.html | 2021-10-06 07:48 | 539K | |
![[TXT]](/icons/text.gif) | the-actors-ichikawa-danjuro-ichik-6cb93ccec5607407.html | 2021-10-06 07:49 | 539K | |
![[TXT]](/icons/text.gif) | september-kyogan-at-the-asakusa-za.html | 2021-10-06 07:49 | 539K | |
![[TXT]](/icons/text.gif) | the-scene-kumagai-jin-ya-from-the-212c7fc9b5705f06.html | 2021-10-06 07:49 | 539K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-as-yashio-from-th-ccda14931435a3f9.html | 2021-10-06 07:49 | 539K | |
![[TXT]](/icons/text.gif) | the-actors-onoe-kikugoro-v-sawamu-59b351872ab09d86.html | 2021-10-06 07:49 | 539K | |
![[TXT]](/icons/text.gif) | actors-sawamura-tossho-ii-nakamur-c605bbf97b796b74.html | 2021-10-06 07:48 | 539K | |
![[TXT]](/icons/text.gif) | ichikawa-danjuro-ix-as-iruka-and--a46d9ee75bc612ca.html | 2021-10-06 07:48 | 540K | |
![[IMG]](/icons/image2.gif) | later print Tsubouchi 800x1610_ | 2021-09-29 07:51 | 540K | |
![[IMG]](/icons/image2.gif) | later print Tsubouchi 800x1610 web.jpg | 2021-10-06 07:49 | 540K | |
![[TXT]](/icons/text.gif) | parody-of-36-selected-beauties-an-52e33aa171ed9019.html | 2021-10-06 07:49 | 540K | |
![[TXT]](/icons/text.gif) | onoe-kikugoro-v-as-masaoka-from-t-9ea5d00392766552.html | 2021-10-06 07:49 | 541K | |
![[ ]](/icons/unknown.gif) | Toyohara_Kunichika-1-2009-08-05 | 2021-09-29 07:51 | 541K | |
![[IMG]](/icons/image2.gif) | Toyohara_Kunichika-1-2009-08-05T20_45_55Z.psd | 2021-10-06 07:49 | 541K | |
![[IMG]](/icons/image2.gif) | Toyohara_Kunichika.psd | 2021-10-06 07:49 | 541K | |
![[TXT]](/icons/text.gif) | a-comparison-of-actors-wages.html | 2021-10-06 07:48 | 541K | |
![[TXT]](/icons/text.gif) | ichimura-uzaemon-from-the-series-kabuki-36-poems.html | 2021-10-06 07:48 | 541K | |
![[TXT]](/icons/text.gif) | geisha-from-the-hiramatsu-restaura-181a24e956f3321.html | 2021-10-06 07:48 | 542K | |
![[TXT]](/icons/text.gif) | a-comparison-of-actors-wages.ht | 2021-09-29 07:51 | 542K | |
![[TXT]](/icons/text.gif) | imoseyama-onna-teikin.html | 2021-10-06 07:48 | 543K | |
![[TXT]](/icons/text.gif) | the-actors-ichikawa-sadanji-otani-35e8f693f5a68424.html | 2021-10-06 07:49 | 543K | |
![[TXT]](/icons/text.gif) | iwai-hanshiro-viii-ichikawa-danju-ac5c90eee85f8f99.html | 2021-10-06 07:48 | 544K | |
![[TXT]](/icons/text.gif) | sawamura-tossho-ii-as-tora-omaru--47a0c76b520afabe.html | 2021-10-06 07:49 | 545K | |
![[TXT]](/icons/text.gif) | the-englishman-spencer-from-the-s-366553ecfd6d7826.html | 2021-10-06 07:49 | 547K | |
![[TXT]](/icons/text.gif) | the-actors-ichikawa-sadanji-ichik-c322aa5535339315.html | 2021-10-06 07:49 | 548K | |
![[TXT]](/icons/text.gif) | shushiki-from-the-series-instruct-c0e80e35a91aadea.html | 2021-10-06 07:49 | 550K | |
![[TXT]](/icons/text.gif) | actors-ichikawa-saidanji-ichikawa-4a63bdadb30afa8e.html | 2021-10-06 07:48 | 552K | |
![[IMG]](/icons/image2.gif) | the-actors-ichikawa-danjuro-ich | 2021-09-29 07:51 | 642K | |
![[IMG]](/icons/image2.gif) | the-actors-ichikawa-sadanji-ich | 2021-09-29 07:51 | 687K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Battle-of-the-magi-8 | 2021-09-29 07:51 | 726K | |
![[IMG]](/icons/image2.gif) | Kunichika,-Battle-of-the-magi-8e5be6e19ef1e499.jpg | 2021-10-06 07:49 | 726K | |
![[IMG]](/icons/image2.gif) | kijutsu-soroi-sannin-doji-a-gat | 2021-09-29 07:51 | 825K | |
![[IMG]](/icons/image2.gif) | bando-hikosaburo-v-as-unryu-kur | 2021-09-29 07:51 | 829K | |
![[IMG]](/icons/image2.gif) | no-10-sakaki-from-the-series-th | 2021-09-29 07:51 | 878K | |
![[IMG]](/icons/image2.gif) | ichikawa-danjuro-ix-as-iruka-an | 2021-09-29 07:51 | 886K | |
![[IMG]](/icons/image2.gif) | geisha-stringing-a-shamisen-fro | 2021-09-29 07:51 | 915K | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -1 | 2021-09-29 07:51 | 1.0M | |
![[IMG]](/icons/image2.gif) | Kunichika Bando Hikosaburo V -1209636adbfa9f3c.jpg | 2021-10-06 07:48 | 1.0M | |
|